golden pistols script roblox pastebin --[[Golden Gun --This gun has a ability to kill everyting in one hit and the color is gold! --fires in a speed of sound]] plr=game:service'Players'.LocalPlayer ch,char=plr.Character,plr.Character hum=ch.Humanoid tor,torso,rootpart,rj=ch.Torso,ch.Torso,ch.HumanoidRootPart,ch.HumanoidRootPart.RootJoint m,mouse=plr:GetMouse(),plr:GetMouse() cfn,ang,mr,int=CFrame.new,CFrame.Angles,math.rad,Instance.new bc=BrickColor.new golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin head=ch.Head cam=workspace.CurrentCamera rj.C0=cfn() rj.C1=cfn() sheathed=false jammed=false golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin local minimumsize = Vector3.new(0.7,0.7,0.7) --Minimumsize for a part to get divided,higher numbers = less detailed and bigger/less bricks golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin local surface_between_splitted_parts = 'SmoothNoOutlines' --the surface between splitted parts --local fragmented = workspace:FindFirstChild("Fragmented") local fragmentable = workspace --all fragmentable objects should be stored in here local list = {} local brickcount = 0 --local m = Instance.new("Hint",workspace) local storage = {} local fillup = 1000 --it constantly generates new parts until it reaches this number(hacky way to prevent lagspikes if there is a large explosion),change it to 0 if you don´t want it to generate (useless) parts. local maximumstorage = 2000 --it will recycle parts if the number of parts in the storage doesnt exceed this number local storage_position = Vector3.new(0,0,5000) --place them somewhere off the map golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin local stored_partsize = Vector3.new(1,1,1) --make them small local parts_created_per_frame = 5 --number of parts being created per frame to fill up the storage function fragmentate(cframe,size,color,explosion_position,explosion_blastradius,backsurface,bottomsurface,frontsurface,leftsurface,rightsurface,topsurface,transparency,reflectance) local xi = size.X >= minimumsize.X*(1+explosion_blastradius/16) and 2 or 1 --to reduce the lagg in large explosions we increase minimumsize based on the explosionradius... local yi = size.Y >= minimumsize.Y*(1+explosion_blastradius/16) and 2 or 1 local zi = size.Z >= minimumsize.Z*(1+explosion_blastradius/16) and 2 or 1 if xi == 1 and yi == 1 and zi == 1 or (cframe.p-explosion_position).magnitude > size.magnitude/2 + explosion_blastradius then --don´t fragmentate parts, that are too small to fragmentate or too far away from the explosion if xi == 1 and yi == 1 and zi == 1 then return end --optional golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin if #storage > 0 then local p = storage[1] p.BrickColor = color p.Size = size p.BackSurface = backsurface p.BottomSurface = bottomsurface p.FrontSurface = frontsurface p.LeftSurface = leftsurface p.RightSurface = rightsurface p.TopSurface = topsurface golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin p.Transparency = transparency p.CFrame = cframe p.Reflectance = reflectance table.remove(storage,1) else local p = Instance.new("Part",fragmentable) p.BrickColor = color p.FormFactor = "Custom" p.Size = size p.BackSurface = backsurface golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin p.BottomSurface = bottomsurface p.FrontSurface = frontsurface p.LeftSurface = leftsurface p.RightSurface = rightsurface p.TopSurface = topsurface p.Transparency = transparency if p.Transparency>0.285 then p.Anchored = false else p.Anchored=true golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin p.Material='Wood' end p.CFrame = cframe p.Reflectance = reflectance end --p:MakeJoints() -- m.Text = m.Text+1 return --stop the function end local mody = math.random(-125,125)/1000 --some randomization golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin for y = 1,yi do if math.random()> 0.5 then local modx = math.random(-125,125)/1000 for x = 1,xi do local modz = math.random(-125,125)/1000 for z = 1,zi do --offset = x/xi-0.75+modx) fragmentate(cframe*CFrame.new(size.X*(xi==1 and 0 or x/xi-0.75+modx),size.Y*(yi==1 and 0 or y/yi-0.75+mody),size.Z*(zi==1 and 0 or z/zi-0.75+modz)), --maths Vector3.new(xi == 2 and size.X*(1-2*math.abs(x/xi-0.75+modx)) or size.X,yi == 2 and size.Y*(1-2*math.abs(y/yi-0.75+mody)) or size.Y, zi == 2 and size.Z*(1-2*math.abs(z/zi-0.75+modz)) or size.Z or agent767_was_here),color,explosion_position,explosion_blastradius, z~=zi and surface_between_splitted_parts or backsurface,y==2 and surface_between_splitted_parts or bottomsurface, golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin z==2 and surface_between_splitted_parts or frontsurface,x==2 and surface_between_splitted_parts or leftsurface,x~=xi and surface_between_splitted_parts or rightsurface, y~=yi and surface_between_splitted_parts or topsurface,transparency,reflectance) end end else local modz = math.random(-125,125)/1000 for z = 1,zi do local modx = math.random(-125,125)/1000 for x = 1,xi do golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin fragmentate(cframe*CFrame.new(size.X*(xi==1 and 0 or x/xi-0.75+modx),size.Y*(yi==1 and 0 or y/yi-0.75+mody),size.Z*(zi==1 and 0 or z/zi-0.75+modz)), Vector3.new(xi == 2 and size.X*(1-2*math.abs(x/xi-0.75+modx)) or size.X,yi == 2 and size.Y*(1-2*math.abs(y/yi-0.75+mody)) or size.Y, zi == 2 and size.Z*(1-2*math.abs(z/zi-0.75+modz)) or size.Z),color,explosion_position,explosion_blastradius, z~=zi and surface_between_splitted_parts or backsurface,y==2 and surface_between_splitted_parts or bottomsurface, z==2 and surface_between_splitted_parts or frontsurface,x==2 and surface_between_splitted_parts or leftsurface,x~=xi and surface_between_splitted_parts or rightsurface, y~=yi and surface_between_splitted_parts or topsurface,transparency,reflectance) end end end end golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin end function start_fragmentation(position,radius) local search = Region3.new(position-Vector3.new(radius,radius,radius)*1.1,position+Vector3.new(radius,radius,radius)*1.1) repeat local finish = false local parts = workspace:FindPartsInRegion3WithIgnoreList(search,list,100) --maximum number of parts that FindPartsInRegion3 can find is 100, so we have to do this to find them all for i = 1,#parts do table.insert(list,1,parts[i]) end golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin finish = true until #parts < 100 and finish print(#list) local t = tick() for i = 1,#list do local p = list[i] if p:IsDescendantOf(fragmentable) and p:GetMass()<3000 and p.Transparency>0.285 and p.Name~='Base' and p:IsDescendantOf(ch)==false then fragmentate(p.CFrame,p.Size,p.BrickColor,position,radius,p.BackSurface,p.BottomSurface,p.FrontSurface,p.LeftSurface,p.RightSurface,p.TopSurface,p.Transparency,p.Reflectance) if #storage < maximumstorage and p.Shape == "Block" then --recycle them p.Anchored = false golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin p.FormFactor = "Custom" p.Size = stored_partsize p.Position = storage_position table.insert(storage,1,p) else --storage is full p:Destroy() end -- m.Text = m.Text-1 end if p:IsDescendantOf(fragmentable) and p:GetMass()<53000 and p.Transparency<0.05 and p.Name~='Base' and tostring(p.Material)=='Enum.Material.Wood' and p:IsDescendantOf(ch)==false then golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin fragmentate(p.CFrame,p.Size,p.BrickColor,position,radius,p.BackSurface,p.BottomSurface,p.FrontSurface,p.LeftSurface,p.RightSurface,p.TopSurface,p.Transparency,p.Reflectance) if #storage < maximumstorage and p.Shape == "Block" then --recycle them p.Anchored = true p.Material='Wood' p.FormFactor = "Custom" p.Size = stored_partsize p.Position = storage_position table.insert(storage,1,p) else --storage is full p:Destroy() golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin end -- m.Text = m.Text-1 end end list = {} -- print(tick()-t) end --[[ spawn(function() golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin while wait() do --oh noes,a loop! So inefficient! if #storage < fillup then for i = 1, parts_created_per_frame do --creates parts to fill up the storage local p = Instance.new("Part",fragmentable) p.Anchored = false p.FormFactor = "Custom" p.Size = stored_partsize p.Position = storage_position table.insert(storage,1,p) end golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin end end end) ]] golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin --local blankn=22416261 --172121567 golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin crosshairs={ {38140824}; {38140833}; {38140839}; {38140843}; {38140852}; {38140910}; {38140915}; {38140923}; golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin {38140928}; {38140931}; {38208259}; {38208275}; {38208284}; {38208303}; {38208310}; {38208325}; {38208330}; {38208352}; golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin {38208359}; {38208377} } bulletholes={ 172274695; 172274721 } for _,v in pairs(crosshairs) do golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin game:service'ContentProvider':Preload('rbxassetid://' .. tostring(v[1]-1)) end currentIco=2 switchIco=function(num) if num<20 then else num=20 end mouse.Icon='rbxassetid://' .. tostring(crosshairs[num][1]-1) golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin currentIco=num end switchIco(currentIco) heldDown=false spreadint=1 --[[Settings]]-- recoil=false -- Set to true for added realism golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin magCapacity=1 -- How much a magazine can hold at once magAmmo=1 -- How much ammo is in the mag crosshairSpread=5 spread=1 pAmmunition=true -- more damage if true jamRate=500 -- How often the gun jams(the more the less) (no less than 1) primaryColor='Gold' golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin secondaryColor='Gold' slideReflectance=0.01 slideMaterial='Concrete' --[[Attachments]]-- silencer=true highCapMag=true -- makes gun have 500 in mag instead of 1 laser=true golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin automatic=true grip=true getSound=function(id) game:service'ContentProvider':Preload('rbxassetid'..tostring(id)) local s=int("Sound",ch.Head) s.SoundId='rbxassetid://' .. tostring(id) s.Volume=1 return s golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin end local fireSound=getSound(811841430--[[811841430]]) fireSound.Pitch=1.3 --1.8 local releaseSound=getSound(811841430) releaseSound.Pitch=4 local reloadSound=getSound(811841430) golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin reloadSound.Pitch=3 local magazinelockSound=getSound(811841430) magazinelockSound.Pitch=1.4 local slideBackSound=getSound(811841430) slideBackSound.Pitch=2.5 local slideForwardSound=getSound(811841430) slideForwardSound.Pitch=2.5 golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin local emptySound=getSound(811841430) emptySound.Pitch=5 local glassBreakSound=getSound(811841430) local woodImpact=getSound(811841430) local fleshImpact=getSound(811841430) fleshImpact.Pitch=1.7 golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin if ch:findFirstChild("Tec-99") then ch['Tec-99']:Destroy() end local tube=int("Model",ch) tube.Name='Tec-99' local hopper=Instance.new('HopperBin',plr.Backpack) hopper.Name=tube.Name Weld = function(p0,p1,x,y,z,rx,ry,rz,par)--recommend to use this with my weld. use this function only with arm lockers. golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin p0.Position = p1.Position local w = Instance.new('Motor',par or p0) w.Part0 = p1 w.Part1 = p0 w.C0 = CFrame.new(x or 0,y or 0,z or 0)*CFrame.Angles(rx or 0,ry or 0,rz or 0) w.MaxVelocity = .1 return w end function clerp(c1,c2,sp) local R1,R2,R3 = c1:toEulerAnglesXYZ() golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin local R21,R22,R23 = c2:toEulerAnglesXYZ() return CFrame.new( c1.X + (c2.X-c1.X)*sp, c1.Y + (c2.Y-c1.Y)*sp, c1.Z + (c2.Z-c1.Z)*sp)*CFrame.Angles( R1 + (R21-R1)*sp, R2 + (R22-R2)*sp, R3 + (R23-R3)*sp ) end golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin tweenTable={} Tween = function(Weld, Stop, Step,a) ypcall(function() local func = function() local Start = Weld.C1 local X1, Y1, Z1 = Start:toEulerAnglesXYZ() local Stop = Stop local X2, Y2, Z2 = Stop:toEulerAnglesXYZ() if not Step then Step=0.1 end golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin table.insert(tweenTable,{th=0,Weld=Weld,Step=Step,Start=Start,X1=X1,Y1=Y1,Z1=Z1,Stop=Stop,X2=X2,Y2=Y2,Z2=Z2}) end if a then coroutine.wrap(func)() else func() end end) end weld=function(p0,p1,c0) local w=Instance.new("Weld",p0) w.Part0=p0 w.Part1=p1 w.C0=c0 golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin return w end cp=function(parent,color,size,anchored,cancollide) local newp=Instance.new("Part",parent) newp.TopSurface='SmoothNoOutlines' newp.BottomSurface='SmoothNoOutlines' newp.FrontSurface='SmoothNoOutlines' newp.BackSurface='SmoothNoOutlines' newp.RightSurface='SmoothNoOutlines' newp.LeftSurface='SmoothNoOutlines' golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin newp.FormFactor="Custom" newp.BrickColor=bc(color) newp.Size=size newp.Anchored=anchored newp.CanCollide=cancollide newp:BreakJoints() return newp end initializeJoints=function() golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin rabr = cp(tube,'White',Vector3.new(1,1,1),false,false) rabr.Transparency = 1 rabr.Name='Locker' rabr.Position = torso.Position rw = Weld(rabr,torso,1.5,.5,0,0,0,0) rw.Parent = tube rw.Name = 'rw' w = Instance.new("Weld",tube) w.Part0,w.Part1 = ch['Right Arm'],rabr w.C1 = CFrame.new(0,-.5,0) labr = cp(tube,'White',Vector3.new(1,1,1),false,false) labr.Transparency = 1 labr.Name='Locker' labr.Position = torso.Position lw = Weld(labr,torso,-1.5,.5,0,0,0,0) lw.Parent = tube lw.Name = 'lw' ww = Instance.new("Weld",tube) golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin ww.Part0,ww.Part1 = ch['Left Arm'],labr ww.C1 = CFrame.new(0,-.5,0) end initializeJoints() --[[ leg locks rabl = cp(tube,'White',Vector3.new(1,1,1),false,false) rabl.Transparency = 1 rabl.Name='Locker' rabl.Position = torso.Position rwl = Weld(rabl,torso,0.5,-1.5,0,0,0,0) rwl.Parent = tube rwl.Name = 'rwl' golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin wl = Instance.new("Weld",tube) wl.Part0,wl.Part1 = ch['Right Leg'],rabl wl.C1 = CFrame.new(0,-.5,0) labl = cp(tube,'White',Vector3.new(1,1,1),false,false) labl.Transparency = 1 labl.Name='Locker' labl.Position = torso.Position lwl = Weld(labl,torso,-0.5,-1.5,0,0,0,0) lwl.Parent = tube lwl.Name = 'lwl' wwl = Instance.new("Weld",tube) wwl.Part0,wwl.Part1 = ch['Left Leg'],labl wwl.C1 = CFrame.new(0,-.5,0) ]] golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin --weld(ch['HumanoidRootPart'],torso,cfn()) local counter=Instance.new('ScreenGui',plr.PlayerGui) local frame=Instance.new('Frame',counter) frame.Size=UDim2.new(0.25,0,0.3,0) frame.Position=UDim2.new(0.1,0,0.4,0) frame.BackgroundTransparency=1 golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin local ammocounter=Instance.new('TextLabel',frame) ammocounter.Size=UDim2.new(1,0,0.3,0) ammocounter.Position=UDim2.new(0,0,0.2,0) ammocounter.BackgroundTransparency=1 ammocounter.TextColor3=BrickColor.new('White').Color ammocounter.Font='SourceSansBold' ammocounter.FontSize='Size18' ammocounter.Text='' ammocounter.TextXAlignment='Left' golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin local bg = Instance.new("BodyGyro",rootpart) bg.maxTorque = Vector3.new(math.huge,math.huge,math.huge) bg.P = 10000 bg.D = 100 cyl=function(prt) local c=int("CylinderMesh",prt) return c golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin end blo=function(prt) local c=int("BlockMesh",prt) return c end if laser then aLaser=cp(tube,'Really red',Vector3.new(0.2,0.2,0.2)) aLaser.Transparency=1 cyl(aLaser).Scale=Vector3.new(0.25,1,0.25) golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin aLaser.Anchored=true end local handle=cp(tube,primaryColor,Vector3.new(0.2,0.6,0.3)) blo(handle).Scale=Vector3.new(1.15,0.9,1) local mw=weld(ch['Right Arm'],handle,cfn(-0.4,-1,-0.19)*ang(mr(-101.5),0,0)*cfn()*ang(0,mr(-30),mr(-5))) local framepiece1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.9)) blo(framepiece1).Scale=Vector3.new(1.15,0.5,1) weld(handle,framepiece1,cfn(0,0.354,-0.3)*ang(mr(11.5),0,0)) golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin local barrel=cp(tube,'Medium stone grey',Vector3.new(0.2,0.2,0.2)) cyl(barrel).Scale=Vector3.new(0.7,1.2,0.7) weld(framepiece1,barrel,cfn(0,0.15,-0.1)*ang(mr(-90),0,0)) local sbarrel=cp(tube,'Really black',Vector3.new(0.2,0.3,0.2)) cyl(sbarrel).Scale=Vector3.new(0.7,1.5,0.7) weld(barrel,sbarrel,cfn(0,0.35,0)) local hole=cp(tube,'White',Vector3.new(0.2,0.2,0.2)) hole.Transparency=1 golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin weld(sbarrel,hole,cfn(0,0.2,0)) local flash=int('PointLight',hole) flash.Enabled=false flash.Range=10 flash.Color=BrickColor.new('Neon orange').Color local slide1=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.4)) slide1.CanCollide=false blo(slide1).Scale=Vector3.new(0.7,1,1.1) golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin slideweld1=weld(framepiece1,slide1,cfn(0,0.15,0.23)) slide1.Reflectance=slideReflectance slide1.Material=slideMaterial local slide2=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.4)) slide2.CanCollide=false blo(slide2).Scale=Vector3.new(0.7,1,1.1) slideweld2=weld(slide1,slide2,cfn(0,0,-0.666)) slide2.Reflectance=slideReflectance slide2.Material=slideMaterial golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin local slideside1=cp(tube,secondaryColor,Vector3.new(0.2,0.2,1.1)) slideside1.CanCollide=true blo(slideside1).Scale=Vector3.new(0.25,1,1) weld(slide1,slideside1,cfn(-0.09,0,-0.335)) slideside1.Reflectance=slideReflectance slideside1.Material=slideMaterial local slideside2=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.4)) slideside2.CanCollide=true golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin blo(slideside2).Scale=Vector3.new(0.25,1,1.1) weld(slide1,slideside2,cfn(0.09,0,0)) slideside2.Reflectance=slideReflectance slideside2.Material=slideMaterial local slideside3=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.3)) slideside3.CanCollide=true blo(slideside3).Scale=Vector3.new(0.25,0.6,0.78) weld(slideside2,slideside3,cfn(0,-0.04,-0.335)) slideside3.Reflectance=slideReflectance golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin slideside3.Material=slideMaterial local slideside4=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.4)) blo(slideside4).Scale=Vector3.new(0.25,1,1.1) weld(slide2,slideside4,cfn(0.09,0,0)) slideside4.Reflectance=slideReflectance slideside4.Material=slideMaterial local mgs=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2)) blo(mgs).Scale=Vector3.new(1.15,0.425,0.245) golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin weld(handle,mgs,cfn(0,-0.3,0.125)) --[[Trigger]]-- local tp1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2)) blo(tp1).Scale=Vector3.new(0.6,0.1,0.8) weld(framepiece1,tp1,cfn(0,-0.22,0.13)) local tp2=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2)) blo(tp2).Scale=Vector3.new(0.6,0.1,1.19) weld(framepiece1,tp2,cfn(0,-0.14,-0.0265)*ang(mr(45),0,0)) golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin local trigger1=cp(tube,'Really black',Vector3.new(0.2,0.2,0.2)) blo(trigger1).Scale=Vector3.new(0.3,0.4,0.16) weld(framepiece1,trigger1,cfn(0,-0.07,0.09)) local trigger2=cp(tube,'Really black',Vector3.new(0.2,0.2,0.2)) blo(trigger2).Scale=Vector3.new(0.3,0.3,0.16) weld(trigger1,trigger2,cfn(0,-0.06,-0.015)*ang(mr(30),0,0)) golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin --[[Magazine]]-- local magh=cp(tube,'Really black',Vector3.new(0.2,0.5,0.2)) blo(magh).Scale=Vector3.new(0.6,1,1) local magweld=weld(handle,magh,cfn(0,-0.025,0)) local bottom=cp(tube,'Really black',Vector3.new(0.2,0.2,0.3)) blo(bottom).Scale=Vector3.new(1.15,0.385,0.8) bottomweld=weld(magh,bottom,cfn(0,-0.28,-0.015)) golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin if highCapMag then magweld:Destroy() magh.Size=Vector3.new(0.2,0.7,0.2) magweld=weld(handle,magh,cfn(0,-0.125,0)) bottomweld:Destroy() bottomweld=weld(magh,bottom,cfn(0,-0.38,-0.015)) magCapacity=magCapacity+499 magAmmo=magAmmo+499 end golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin --[[Sights]]-- local backsight1=cp(tube,'Black',Vector3.new(0.2,0.2,0.2)) blo(backsight1).Scale=Vector3.new(0.3,0.3,0.3) weld(slide1,backsight1,cfn(0.06,0.1,0.13)) local backsight2=cp(tube,'Black',Vector3.new(0.2,0.2,0.2)) blo(backsight2).Scale=Vector3.new(0.3,0.3,0.3) weld(slide1,backsight2,cfn(-0.06,0.1,0.13)) local frontsight=cp(tube,'Black',Vector3.new(0.2,0.2,0.2)) blo(frontsight).Scale=Vector3.new(0.3,0.3,0.3) golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin weld(slide1,frontsight,cfn(0,0.1,-0.85)) local dot1=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2)) cyl(dot1).Scale=Vector3.new(0.1,0.31,0.1) weld(backsight1,dot1,cfn(0,0.014,0)*ang(mr(-90),0,0)) local dot2=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2)) cyl(dot2).Scale=Vector3.new(0.1,0.31,0.1) weld(backsight2,dot2,cfn(0,0.014,0)*ang(mr(-90),0,0)) golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin local dot3=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2)) cyl(dot3).Scale=Vector3.new(0.1,0.31,0.1) weld(frontsight,dot3,cfn(0,0.014,0)*ang(mr(-90),0,0)) local ba=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.2)) blo(ba).Scale=Vector3.new(1.15,0.5,1) weld(framepiece1,ba,cfn(0,0,-0.55)) ba.Reflectance=slideReflectance ba.Material=slideMaterial golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin local weirdholethatpistolshave=cp(tube,'Really black', Vector3.new(0.2,0.2,0.2)) cyl(weirdholethatpistolshave).Scale=Vector3.new(0.4,1.01,0.4) weld(ba,weirdholethatpistolshave,cfn(0,0,0)*ang(mr(-90),0,0)) --[[Tactical Rails]]-- local r1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2)) blo(r1).Scale=Vector3.new(1.15,0.2,0.25) weld(framepiece1,r1,cfn(0,-0.05,-0.17)) golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin local r2=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2)) blo(r2).Scale=Vector3.new(1.15,0.2,0.25) weld(framepiece1,r2,cfn(0,-0.05,-0.27)) local r3=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2)) blo(r3).Scale=Vector3.new(1.15,0.2,0.25) weld(framepiece1,r3,cfn(0,-0.05,-0.37)) if laser then local base=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.3)) golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin blo(base).Scale=Vector3.new(1.15,1,1) weld(r2,base,cfn(0,-0.05,0)) basehole=cp(tube,'White',Vector3.new(0.2,0.2,0.2)) cyl(basehole).Scale=Vector3.new(0.4,0.4,0.4) weld(base,basehole,cfn(0,0,-0.13)*ang(mr(-90),0,0)) end if silencer then local sil=cp(tube,'Really black',Vector3.new(0.2,0.3,0.2)) fireSound.SoundId='rbxassetid://153230595' golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin fireSound.Pitch=1 cyl(sil).Scale=Vector3.new(0.94,1.8,0.94) weld(hole,sil,cfn(0,0.29,0)) end if grip then local base=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.3)) blo(base).Scale=Vector3.new(1.15,1,1) weld(r2,base,cfn(0,-0.05,0)) local hd=cp(tube,primaryColor,Vector3.new(0.2,0.6,0.2)) golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin cyl(hd) weld(base,hd,cfn(0,-0.3,0)) crosshairSpread=3 spreadint=spreadint-0.3 end --[[Test Functions]]-- local debounce=false local out=false golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin local bs=false cockSlide=function() -- hahaha yes i know slideBackSound:Play() if magAmmo<1 and out==true and bs==false then wait() slideweld1.C0=slideweld1.C0*cfn(0,0,0.22) else for i=1,2 do wait() slideweld1.C0=slideweld1.C0*cfn(0,0,0.22) golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin end end local ajar=false if magAmmo==1 then ajar=true end if magAmmo>0 then createShell() --magAmmo=magAmmo-1 ammocounter.Text='' golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin for i=1,magAmmo do ammocounter.Text=ammocounter.Text .. 'I' end end wait(0.15) slideForwardSound:Play() for i=1,2 do wait() slideweld1.C0=slideweld1.C0*cfn(0,0,-0.22) end golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin if ajar==true then out=true slideweld1.C0=cfn(0,0.15,0.23) slideweld1.C0=slideweld1.C0*cfn(0,0,0.22) end end --fx local firefx=cp(tube,'Neon orange',Vector3.new(0.7,1.1,0.7)) firefx.Transparency=1 golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin local mesh=Instance.new('SpecialMesh',firefx) mesh.MeshType='Sphere' firefx.Material='Neon' weld(hole,firefx,cfn(0,1,0)) local smokefx=Instance.new('Smoke',hole) smokefx.Enabled=false barrel.CanCollide=true golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin local oc = oc or function(...) return ... end function ragJoint(hit,r,d) Spawn(oc(function() d = d or 0 local rpar,r0,r1 = r.Parent,r.Part0,r.Part1 if d > 0 then wait(d) end local p = hit:Clone() golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin p:BreakJoints() p:ClearAllChildren() p.FormFactor = "Custom" p.Size = p.Size/2 p.Transparency = 1 p.CanCollide = true p.Name = "Colliduh" p.Parent = hit local w = Instance.new("Weld",p) w.Part0 = hit golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin w.Part1 = p w.C0 = CFrame.new(0,-p.Size.Y/2,0) local rot = Instance.new("Rotate",rpar) rot.Name = r.Name rot.Part0 = r0 rot.Part1 = r1 rot.C0 = r.C0 rot.C1 = r.C1 r0.Velocity = Vector3.new() r1.Velocity = Vector3.new() golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin r:Destroy() end)) end createShell=function() local shell=cp(tube,'Deep orange',Vector3.new(0.2,0.3,0.2)) shell.CanCollide=true shell.Reflectance=0.3 cyl(shell) golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin shell.CFrame=barrel.CFrame*ang(mr(-90),0,0) magAmmo=magAmmo-1 ammocounter.Text='' for i=1,magAmmo do ammocounter.Text=ammocounter.Text .. 'I' end game.Debris:AddItem(shell,3) end reloadPistol=function() golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin local current=magAmmo Tween(lw,cfn()) Tween(rw,cfn()*ang(mr(-102),0,0)) wait(0.4) releaseSound:Play() bottom.Transparency=1 magh.Transparency=1 local mag1=magh:clone() mag1.Transparency=0 mag1.Weld:Destroy'' golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin local mag2=bottom:clone() mag2.Transparency=0 mag1:BreakJoints'' mag2:BreakJoints'' local bm1=mag1:clone() local bm2=mag2:clone() mag1.Parent=tube mag2.Parent=tube mag1.CFrame=magh.CFrame weld(mag1,mag2,cfn(0,-0.28,-0.015)) golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin magAmmo=0 ammocounter.Text='' for i=1,magAmmo do ammocounter.Text=ammocounter.Text .. 'I' end wait() mag1.CanCollide=true mag2.CanCollide=true game.Debris:AddItem(mag1,2) game.Debris:AddItem(mag2,2) golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin wait(0.1) Tween(lw,cfn()*ang(mr(25),0,0)) bm1.Parent=tube bm2.Parent=tube weld(bm1,bm2,cfn(0,-0.28,-0.015)) local fa=weld(ch['Left Arm'],bm1,cfn(0,-1.1,0)*ang(mr(-90),0,0)) wait(0.1) Tween(lw,cfn(0,1.4,0)*ang(mr(-109),mr(60),mr(10)),0.07) wait(0.25) magazinelockSound:Play() golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin wait() -- reloadSound:Play() fa:Destroy'' bm1:Destroy'' bm2:Destroy'' bottom.Transparency=0 magh.Transparency=0 local totalcap=0 if current<1 then --none in chamber reload --slideweld1.C0=cfn(0,0,0.45) golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0)) Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(35),0)) wait(0.1) spawn(function() cockSlide() end) Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(55),0)) wait(0.3) totalcap=magCapacity else golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin totalcap=magCapacity+1 end magAmmo=totalcap out=false ammocounter.Text='' for i=1,magAmmo do ammocounter.Text=ammocounter.Text .. 'I' end restorePosition() end golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin firePistol=function() switchIco(currentIco+crosshairSpread) if not jammed and not out then spread=spread+spreadint end print(spread) fireSound.Pitch=math.random(math.random(fireSound.Pitch-0.2,fireSound.Pitch-0.1),math.random(fireSound.Pitch,fireSound.Pitch+0.1)) if magAmmo>0 and jammed==false then local ajar=false golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin if magAmmo==1 then ajar=true end user=ch local ray = Ray.new(hole.CFrame.p, ((m.Hit.p+Vector3.new(math.random(-spread,spread)/6.35,math.random(-spread,spread)/6.35,math.random(-spread,spread)/6.35) )- hole.CFrame.p).unit*300) local hit, position = game.Workspace:FindPartOnRay(ray, user) if hit then if hit.Transparency>0.285 and hit:GetMass()<3000 and hit.Parent.className~='Hat' then local temps=glassBreakSound:clone() temps.Parent=hit golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin temps.Pitch=math.random(math.random(temps.Pitch-0.2,temps.Pitch-0.1),math.random(temps.Pitch,temps.Pitch+0.1)) temps:Play'' start_fragmentation(position,.25) end if tostring(hit.Material)=='Enum.Material.Wood' and hit.Transparency<0.05 then local temps=woodImpact:clone() temps.Volume=1 temps.Pitch=math.random(math.random(temps.Pitch-0.2,temps.Pitch-0.1),math.random(temps.Pitch,temps.Pitch+0.1)) temps.Parent=hit temps:Play'' golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin start_fragmentation(position,.15) end ypcall(function() if hit and hit.Parent and hit.Parent:findFirstChild'Humanoid' then local temps=fleshImpact:clone() temps.Parent=hit temps:Play() if hit.Name~='Head' then if pAmmunition==true then hit.Parent.Humanoid:TakeDamage(math.huge) golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin else hit.Parent.Humanoid:TakeDamage(math.huge) end local guy=hit.Parent if guy.Name~='TheDarkRevenant' then for i,v in pairs(guy:GetChildren()) do if v.className=='Hat' then v.Handle:BreakJoints() end local r = guy.Torso:FindFirstChild(v.Name:gsub("Arm","Shoulder"):gsub("Leg","Hip")) golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin if v:IsA("BasePart") and r then ragJoint(v,r,.1) elseif v:IsA("Humanoid") then spawn(function() wait(0.5) v.PlatformStand = true v.Changed:connect(function() v.PlatformStand = true end) end) golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin end end end else if hit.Parent.Name~='TheDarkRevenant' then hit.Parent:BreakJoints() end end end golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin if hit.Parent.className=='Hat' then hit.CanCollide=true hit:BreakJoints() hit.Velocity=m.Hit.p*5 end end) end if m.Target then local p = Instance.new("Part") golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin p.formFactor = "Custom" p.Size = Vector3.new(0.5,0.5,0.5) p.Transparency = 1 p.CanCollide = false p.Locked = true p.CFrame = CFrame.new(position.x,position.y,position.z)--mouse.Target.CFrame+(mouse.Hit.p-mouse.Target.Position) local w = Instance.new("Weld") w.Part0 = mouse.Target w.Part1 = p w.C0 = mouse.Target.CFrame:inverse() golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin w.C1 = p.CFrame:inverse() w.Parent = p local d = Instance.new("Decal") d.Parent = p d.Face = mouse.TargetSurface d.Texture = 'rbxassetid://' .. tostring(bulletholes[math.random(#bulletholes)]-2) p.Parent = tube game.Debris:AddItem(p,6) end if recoil==true then golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin cam:SetRoll(math.random(-2,2)) cam:TiltUnits(0.501) end local th=cp(tube,"Really black",Vector3.new(1,1,1)) th.CanCollide=false th.Anchored=true th.CFrame=CFrame.new(position.x,position.y,position.z) local spm=Instance.new('SpecialMesh',th) spm.MeshType='Sphere' spm.Scale=Vector3.new(0.05,0.05,0.05) golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin spawn(function() for i=1,5 do wait() spm.Scale=spm.Scale+Vector3.new(0.16,0.16,0.16) th.Transparency=th.Transparency+0.2 end th:Destroy() end) fireSound:Play() spawn(function() golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin firefx.Transparency=0 wait() firefx.Transparency=1 end) spawn(function() flash.Enabled=true for i=1,2 do wait() slideweld1.C0=slideweld1.C0*cfn(0,0,0.22) end golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin flash.Enabled=false createShell() for i=1,2 do wait() slideweld1.C0=slideweld1.C0*cfn(0,0,-0.22) end slideweld1.C0=cfn(0,0.15,0.23) if ajar==true then out=true slideweld1.C0=cfn(0,0.15,0.23) golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin slideweld1.C0=slideweld1.C0*cfn(0,0,0.22) end end) ammocounter.Text='' for i=1,magAmmo do ammocounter.Text=ammocounter.Text .. 'B' end wait() Tween(rw,cfn(0,0.7,0)*ang(mr(-100),mr(-30),0),0.62) if not grip then golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin Tween(lw,cfn(0,0.7,0)*ang(mr(-100),mr(30),0),0.62) else Tween(lw,cfn(0,1.3,0)*ang(mr(-100),mr(30),0),0.62) end wait(0.065) restorePosition(0.3) else if magAmmo<1 then slideweld1.C0=cfn(0,0.15,0.23) slideweld1.C0=slideweld1.C0*cfn(0,0,0.22) golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin end emptySound:Play() end if math.random(jamRate)==jamRate and magAmmo>0 then jammed=true end end debounced=function() if sheathed==false and debounce==false then golden pistols script roblox pastebin PasteShr golden pistols script roblox pastebin return true end end mouse.Button1Down:connect(function() if debounced() then if automatic==false then debounce=true firePistol() debounce=false golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin else heldDown=true firePistol() end end end) mouse.Button1Up:connect(function() heldDown=false end) golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin sheathGun=function() ammocounter.Visible=false if laser then laserEnabled=false aLaser.Transparency=1 end Tween(rw,cfn()) Tween(lw,cfn()) wait(0.1) golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin mw:Destroy'' mw=nil mw=weld(tor,handle,cfn(1.11,-1.09,0)*ang(mr(-111.5),0,0)) labr:Destroy() rabr:Destroy() bg.maxTorque=Vector3.new() sheathed=true end unsheathGun=function() golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin ammocounter.Visible=true mw:Destroy'' mw=nil initializeJoints() mw=weld(ch['Right Arm'],handle,cfn(-0.4,-1,-0.19)*ang(mr(-101.5),0,0)*cfn()*ang(0,mr(-30),mr(-5))) restorePosition() bg.maxTorque = Vector3.new(math.huge,math.huge,math.huge) sheathed=false end golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin laserEnabled=false mouse.KeyDown:connect(function(key) if key=='r' and debounced() then debounce=true reloadPistol() debounce=false elseif key=='f' and debounced() then debounce=true bs=true golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0)) Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(35),0)) wait(0.1) spawn(function() cockSlide() end) Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(55),0)) wait(0.3) jammed=false restorePosition() golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin bs=false debounce=false elseif key=='l' and debounced() then if not laserEnabled then laserEnabled=true aLaser.Transparency=0.35 else laserEnabled=false aLaser.Transparency=1 end golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin end end) restorePosition=function(speed) if not grip then Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0),speed) Tween(lw,cfn(0,0.7,0)*ang(mr(-90),mr(30),0),speed) else Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0),speed) Tween(lw,cfn(0,1.3,0)*ang(mr(-90),mr(30),0),speed) golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin end end hopper.Selected:connect(function() unsheathGun() end) hopper.Deselected:connect(function() sheathGun() end) golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin game:service'RunService'.RenderStepped:connect(function() bg.cframe = CFrame.new(rootpart.Position,mouse.Hit.p*Vector3.new(1,0,1)+rootpart.Position*Vector3.new(0,1,0)) if laserEnabled==true then local user=ch local ray = Ray.new(hole.CFrame.p, (m.Hit.p - hole.CFrame.p).unit*300) local hit, position = game.Workspace:FindPartOnRay(ray, user) local distance = (position - basehole.CFrame.p).magnitude aLaser.Size=Vector3.new(0.2,distance,0.2) aLaser.CFrame=CFrame.new(position, basehole.CFrame.p) * CFrame.new(0, 0, -distance/2) * ang(mr(-90),0,0) golden pistols script roblox pastebin How to use it? golden pistols script roblox pastebin end for _,v in pairs(tweenTable) do if v.Weld.C1==v.Stop then table.remove(tweenTable,_) else if v.th<0.9 then v.th=v.th+v.Step i=v.th v.Weld.C1 = CFrame.new( (v.Start.p.X * (1 - i)) + (v.Stop.p.X * i), (v.Start.p.Y * (1 - i)) + (v.Stop.p.Y * i), golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin (v.Start.p.Z * (1 - i)) + (v.Stop.p.Z * i)) * CFrame.fromEulerAnglesXYZ( (v.X1 * (1 - i)) + (v.X2 * i), (v.Y1 * (1 - i)) + (v.Y2 * i), (v.Z1 * (1 - i)) + (v.Z2 * i) ) else v.Weld.C1 = v.Stop end end end end) for i=1,magAmmo do golden pistols script roblox pastebin How to get it for free? golden pistols script roblox pastebin ammocounter.Text=ammocounter.Text .. 'I' end sheathGun() spawn(function() while wait(0.07) do if heldDown==true then spawn(function() firePistol() golden pistols script roblox pastebin How to get it? golden pistols script roblox pastebin end) end end end) m.TargetFilter=tube while wait(0.03) do if spread>1 then spread=spread-spreadint/4 end golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin if spread<1 then spread=1 end if currentIco>2 then switchIco(currentIco-1) end end --hl/https://httpget-inumeration.c9.io/mp45.lua --local/game.Players.Conmiro:Destroy'' golden pistols script roblox pastebin How to dowload it? golden pistols script roblox pastebin golden pistols script roblox pastebin